C24H24F3NO2 — CID 14726689
2-ethoxy-5-[1,1,1-trifluoro-5-(3-phenoxyphenyl)pentan-2-yl]pyridine (PubChem CID 14726689) has the molecular formula C24H24F3NO2 and a molecular weight of 415.46 g/mol. Its IUPAC name is 2-ethoxy-5-[1,1,1-trifluoro-5-(3-phenoxyphenyl)pentan-2-yl]pyridine.
| Compound Name | 2-ethoxy-5-[1,1,1-trifluoro-5-(3-phenoxyphenyl)pentan-2-yl]pyridine |
|---|---|
| PubChem CID | 14726689 |
| Molecular Formula | C24H24F3NO2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-ethoxy-5-[1,1,1-trifluoro-5-(3-phenoxyphenyl)pentan-2-yl]pyridine |
| SMILES | CCOc1ccc(C(CCCc2cccc(Oc3ccccc3)c2)C(F)(F)F)cn1 |
| InChI | InChI=1S/C24H24F3NO2/c1-2-29-23-15-14-19(17-28-23)22(24(25,26)27)13-7-9-18-8-6-12-21(16-18)30-20-10-4-3-5-11-20/h3-6,8,10-12,14-17,22H,2,7,9,13H2,1H3 |
| InChIKey | JGTQMLUIPFZHLQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |