C11H11F3O6S — CID 23090775
2-propan-2-yloxy-4-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 23090775) has the molecular formula C11H11F3O6S and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-propan-2-yloxy-4-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | 2-propan-2-yloxy-4-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 23090775 |
| Molecular Formula | C11H11F3O6S |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-propan-2-yloxy-4-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | CC(C)Oc1cc(OS(=O)(=O)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C11H11F3O6S/c1-6(2)19-9-5-7(3-4-8(9)10(15)16)20-21(17,18)11(12,13)14/h3-6H,1-2H3,(H,15,16) |
| InChIKey | LGLCMXQQILLLIJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|