C10H6F6O4 — CID 22971768
4-(1,1,2,3,3,3-hexafluoropropoxy)-2-hydroxybenzoic acid (PubChem CID 22971768) has the molecular formula C10H6F6O4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-(1,1,2,3,3,3-hexafluoropropoxy)-2-hydroxybenzoic acid.
| Compound Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22971768 |
| Molecular Formula | C10H6F6O4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-(1,1,2,3,3,3-hexafluoropropoxy)-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC(F)(F)C(F)C(F)(F)F)cc1O |
| InChI | InChI=1S/C10H6F6O4/c11-8(9(12,13)14)10(15,16)20-4-1-2-5(7(18)19)6(17)3-4/h1-3,8,17H,(H,18,19) |
| InChIKey | CIMKKYWXNOMOAR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |