C10H3F9O3 — CID 139617721
2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (PubChem CID 139617721) has the molecular formula C10H3F9O3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.
| Compound Name | 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid |
|---|---|
| PubChem CID | 139617721 |
| Molecular Formula | C10H3F9O3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(OC(F)(F)C(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C10H3F9O3/c11-3-1-2(7(20)21)4(12)6(5(3)13)22-10(18,19)8(14)9(15,16)17/h1,8H,(H,20,21) |
| InChIKey | HEVPAGUSSYEMAM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|