2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid

C10H3F9O3 — CID 139617721

IUPAC2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
SMILESO=C(O)c1cc(F)c(F)c(OC(F)(F)C(F)C(F)(F)F)c1F
InChIInChI=1S/C10H3F9O3/c11-3-1-2(7(20)21)4(12)6(5(3)13)22-10(18,19)8(14)9(15,16)17/h1,8H,(H,20,21)
InChIKeyHEVPAGUSSYEMAM-UHFFFAOYSA-N
MW342.11 g/mol
LogP3.67
Rot. Bonds4

About 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid

2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (PubChem CID 139617721) has the molecular formula C10H3F9O3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.

Molecular Properties

Compound Name2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
PubChem CID139617721
Molecular FormulaC10H3F9O3
Molecular Weight342.11 g/mol
Exact Mass341.99
IUPAC Name2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid
SMILESO=C(O)c1cc(F)c(F)c(OC(F)(F)C(F)C(F)(F)F)c1F
InChIInChI=1S/C10H3F9O3/c11-3-1-2(7(20)21)4(12)6(5(3)13)22-10(18,19)8(14)9(15,16)17/h1,8H,(H,20,21)
InChIKeyHEVPAGUSSYEMAM-UHFFFAOYSA-N
XLogP3.67
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.11
LogP ≤ 53.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The IUPAC name of 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid (CID 139617721) is 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid.
What is the SMILES notation for 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The canonical SMILES for 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid is O=C(O)c1cc(F)c(F)c(OC(F)(F)C(F)C(F)(F)F)c1F.
What is the InChIKey of 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
The InChIKey is HEVPAGUSSYEMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3F9O3/c11-3-1-2(7(20)21)4(12)6(5(3)13)22-10(18,19)8(14)9(15,16)17/h1,8H,(H,20,21).
What are the key properties of 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid?
2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid has a molecular weight of 342.11 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluoro-3-(1,1,2,3,3,3-hexafluoropropoxy)benzoic acid is sourced from PubChem (CID 139617721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).