C14H10F6N2O3 — CID 150075770
(Z)-2-cyano-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-hydroxybut-2-enamide (PubChem CID 150075770) has the molecular formula C14H10F6N2O3 and a molecular weight of 368.23 g/mol. Its IUPAC name is (Z)-2-cyano-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-hydroxybut-2-enamide.
| Compound Name | (Z)-2-cyano-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 150075770 |
| Molecular Formula | C14H10F6N2O3 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (Z)-2-cyano-N-[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-hydroxybut-2-enamide |
| SMILES | C/C(O)=C(\C#N)C(=O)Nc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F6N2O3/c1-7(23)10(6-21)11(24)22-8-2-4-9(5-3-8)25-14(19,20)12(15)13(16,17)18/h2-5,12,23H,1H3,(H,22,24)/b10-7- |
| InChIKey | DQFOYZYRQBWOJM-YFHOEESVSA-N |
| XLogP | 3.85 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|