C15H17F6NO3 — CID 122039805
2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]pentanoic acid (PubChem CID 122039805) has the molecular formula C15H17F6NO3 and a molecular weight of 373.29 g/mol. Its IUPAC name is 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]pentanoic acid.
| Compound Name | 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 122039805 |
| Molecular Formula | C15H17F6NO3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]pentanoic acid |
| SMILES | CCCC(NCc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H17F6NO3/c1-2-3-11(12(23)24)22-8-9-4-6-10(7-5-9)25-15(20,21)13(16)14(17,18)19/h4-7,11,13,22H,2-3,8H2,1H3,(H,23,24) |
| InChIKey | OTTMCTJGTFQRFV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |