C16H19F6NO3 — CID 122044121
2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]-4-methylpentanoic acid (PubChem CID 122044121) has the molecular formula C16H19F6NO3 and a molecular weight of 387.32 g/mol. Its IUPAC name is 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122044121 |
| Molecular Formula | C16H19F6NO3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCc1ccc(OC(F)(F)C(F)C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C16H19F6NO3/c1-9(2)7-12(13(24)25)23-8-10-3-5-11(6-4-10)26-16(21,22)14(17)15(18,19)20/h3-6,9,12,14,23H,7-8H2,1-2H3,(H,24,25) |
| InChIKey | HICJDJVYUSTRFL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |