C20H23ClFNO3 — CID 66528375
2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid (PubChem CID 66528375) has the molecular formula C20H23ClFNO3 and a molecular weight of 379.86 g/mol. Its IUPAC name is 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66528375 |
| Molecular Formula | C20H23ClFNO3 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCc1ccc(OCc2c(F)cccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C20H23ClFNO3/c1-13(2)10-19(20(24)25)23-11-14-6-8-15(9-7-14)26-12-16-17(21)4-3-5-18(16)22/h3-9,13,19,23H,10-12H2,1-2H3,(H,24,25) |
| InChIKey | HZBRSXICILDQJK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |