C14H18F3NO3 — CID 120509529
2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]pentanoic acid (PubChem CID 120509529) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]pentanoic acid.
| Compound Name | 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 120509529 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[[3-(2,2,2-trifluoroethoxy)phenyl]methylamino]pentanoic acid |
| SMILES | CCCC(NCc1cccc(OCC(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H18F3NO3/c1-2-4-12(13(19)20)18-8-10-5-3-6-11(7-10)21-9-14(15,16)17/h3,5-7,12,18H,2,4,8-9H2,1H3,(H,19,20) |
| InChIKey | PCKUIAGYCQRZPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |