C16H13Cl2F4NO2 — CID 46892159
(1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol (PubChem CID 46892159) has the molecular formula C16H13Cl2F4NO2 and a molecular weight of 398.18 g/mol. Its IUPAC name is (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol.
| Compound Name | (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 46892159 |
| Molecular Formula | C16H13Cl2F4NO2 |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol |
| SMILES | N[C@H](c1ccc(Cl)c(Cl)c1)[C@@H](O)c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H13Cl2F4NO2/c17-11-6-3-9(7-12(11)18)13(23)14(24)8-1-4-10(5-2-8)25-16(21,22)15(19)20/h1-7,13-15,24H,23H2/t13-,14+/m1/s1 |
| InChIKey | IWZHNGFPIXYSJW-KGLIPLIRSA-N |
| XLogP | 4.96 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|