C17H21Cl2NOSi — CID 46892022
(1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-(4-trimethylsilylphenyl)ethanol (PubChem CID 46892022) has the molecular formula C17H21Cl2NOSi and a molecular weight of 354.35 g/mol. Its IUPAC name is (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-(4-trimethylsilylphenyl)ethanol.
| Compound Name | (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-(4-trimethylsilylphenyl)ethanol |
|---|---|
| PubChem CID | 46892022 |
| Molecular Formula | C17H21Cl2NOSi |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (1S,2R)-2-amino-2-(3,4-dichlorophenyl)-1-(4-trimethylsilylphenyl)ethanol |
| SMILES | C[Si](C)(C)c1ccc([C@H](O)[C@H](N)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H21Cl2NOSi/c1-22(2,3)13-7-4-11(5-8-13)17(21)16(20)12-6-9-14(18)15(19)10-12/h4-10,16-17,21H,20H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | UMLYSIWVXIMGKD-SJORKVTESA-N |
| XLogP | 4.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|