C20H23Cl2NO3 — CID 75228946
2-amino-2-(3,4-dichlorophenyl)-1-[4-(oxan-4-ylmethoxy)phenyl]ethanol (PubChem CID 75228946) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-amino-2-(3,4-dichlorophenyl)-1-[4-(oxan-4-ylmethoxy)phenyl]ethanol.
| Compound Name | 2-amino-2-(3,4-dichlorophenyl)-1-[4-(oxan-4-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 75228946 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-amino-2-(3,4-dichlorophenyl)-1-[4-(oxan-4-ylmethoxy)phenyl]ethanol |
| SMILES | NC(c1ccc(Cl)c(Cl)c1)C(O)c1ccc(OCC2CCOCC2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO3/c21-17-6-3-15(11-18(17)22)19(23)20(24)14-1-4-16(5-2-14)26-12-13-7-9-25-10-8-13/h1-6,11,13,19-20,24H,7-10,12,23H2 |
| InChIKey | SQKHNLFQBZINAO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |