C19H22Cl3NO3 — CID 59446365
2-[[4-[(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-hydroxyethyl]phenoxy]methyl]-3-chloro-2-methylpropan-1-ol (PubChem CID 59446365) has the molecular formula C19H22Cl3NO3 and a molecular weight of 418.75 g/mol. Its IUPAC name is 2-[[4-[(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-hydroxyethyl]phenoxy]methyl]-3-chloro-2-methylpropan-1-ol.
| Compound Name | 2-[[4-[(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-hydroxyethyl]phenoxy]methyl]-3-chloro-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 59446365 |
| Molecular Formula | C19H22Cl3NO3 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[[4-[(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-hydroxyethyl]phenoxy]methyl]-3-chloro-2-methylpropan-1-ol |
| SMILES | CC(CO)(CCl)COc1ccc([C@@H](O)[C@@H](N)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22Cl3NO3/c1-19(9-20,10-24)11-26-14-5-2-12(3-6-14)18(25)17(23)13-4-7-15(21)16(22)8-13/h2-8,17-18,24-25H,9-11,23H2,1H3/t17-,18+,19?/m0/s1 |
| InChIKey | WYDGLWRRXQWOOJ-PAMZHZACSA-N |
| XLogP | 4.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|