C11H6Br2F6O3 — CID 98041674
2-bromo-1-[3-bromo-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone (PubChem CID 98041674) has the molecular formula C11H6Br2F6O3 and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-bromo-1-[3-bromo-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone.
| Compound Name | 2-bromo-1-[3-bromo-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 98041674 |
| Molecular Formula | C11H6Br2F6O3 |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 457.86 |
| IUPAC Name | 2-bromo-1-[3-bromo-4-[(2R)-1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl]ethanone |
| SMILES | O=C(CBr)c1ccc(OC(F)(F)[C@@H](F)OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H6Br2F6O3/c12-4-7(20)5-1-2-8(6(13)3-5)21-10(15,16)9(14)22-11(17,18)19/h1-3,9H,4H2/t9-/m0/s1 |
| InChIKey | FZFIQRSUZUJVIW-VIFPVBQESA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|