C10H5BrF6O3 — CID 122360990
3-bromo-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde (PubChem CID 122360990) has the molecular formula C10H5BrF6O3 and a molecular weight of 367.04 g/mol. Its IUPAC name is 3-bromo-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde.
| Compound Name | 3-bromo-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 122360990 |
| Molecular Formula | C10H5BrF6O3 |
| Molecular Weight | 367.04 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 3-bromo-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)(F)C(F)OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H5BrF6O3/c11-6-3-5(4-18)1-2-7(6)19-9(13,14)8(12)20-10(15,16)17/h1-4,8H |
| InChIKey | JKUNFYDSBSPOOV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.04 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|