C22H26F3NO2 — CID 23343925
N-heptyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine (PubChem CID 23343925) has the molecular formula C22H26F3NO2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-heptyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine.
| Compound Name | N-heptyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 23343925 |
| Molecular Formula | C22H26F3NO2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-heptyl-1-[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenyl]methanimine |
| SMILES | CCCCCCC/N=C/c1ccc(OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H26F3NO2/c1-2-3-4-5-6-15-26-16-18-7-11-20(12-8-18)27-17-19-9-13-21(14-10-19)28-22(23,24)25/h7-14,16H,2-6,15,17H2,1H3/b26-16+ |
| InChIKey | PBGXCIRIOYTULR-WGOQTCKBSA-N |
| XLogP | 6.55 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|