C55H74N2O6 — CID 102078858
[4-[7-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]heptyliminomethyl]phenyl] 4-decoxybenzoate (PubChem CID 102078858) has the molecular formula C55H74N2O6 and a molecular weight of 859.21 g/mol. Its IUPAC name is [4-[7-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]heptyliminomethyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[7-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]heptyliminomethyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 102078858 |
| Molecular Formula | C55H74N2O6 |
| Molecular Weight | 859.21 g/mol |
| Exact Mass | 858.55 |
| IUPAC Name | [4-[7-[[4-(4-decoxybenzoyl)oxyphenyl]methylideneamino]heptyliminomethyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(/C=N/CCCCCCC/N=C/c3ccc(OC(=O)c4ccc(OCCCCCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H74N2O6/c1-3-5-7-9-11-13-18-22-42-60-50-36-28-48(29-37-50)54(58)62-52-32-24-46(25-33-52)44-56-40-20-16-15-17-21-41-57-45-47-26-34-53(35-27-47)63-55(59)49-30-38-51(39-31-49)61-43-23-19-14-12-10-8-6-4-2/h24-39,44-45H,3-23,40-43H2,1-2H3/b56-44+,57-45+ |
| InChIKey | UELCWQZRZXPZTP-FEUSTZMNSA-N |
| XLogP | 14.65 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.21 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|