C42H48N2O6 — CID 101016601
[4-[8-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]octyliminomethyl]phenyl] 4-propoxybenzoate (PubChem CID 101016601) has the molecular formula C42H48N2O6 and a molecular weight of 676.85 g/mol. Its IUPAC name is [4-[8-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]octyliminomethyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-[8-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]octyliminomethyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 101016601 |
| Molecular Formula | C42H48N2O6 |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | [4-[8-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]octyliminomethyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N/CCCCCCCC/N=C/c3ccc(OC(=O)c4ccc(OCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H48N2O6/c1-3-29-47-37-23-15-35(16-24-37)41(45)49-39-19-11-33(12-20-39)31-43-27-9-7-5-6-8-10-28-44-32-34-13-21-40(22-14-34)50-42(46)36-17-25-38(26-18-36)48-30-4-2/h11-26,31-32H,3-10,27-30H2,1-2H3/b43-31+,44-32+ |
| InChIKey | SUESZPOSUICCRZ-ROIZXALESA-N |
| XLogP | 9.58 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|