C39H42N2O6 — CID 101016578
[4-[5-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]pentyliminomethyl]phenyl] 4-propoxybenzoate (PubChem CID 101016578) has the molecular formula C39H42N2O6 and a molecular weight of 634.77 g/mol. Its IUPAC name is [4-[5-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]pentyliminomethyl]phenyl] 4-propoxybenzoate.
| Compound Name | [4-[5-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]pentyliminomethyl]phenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 101016578 |
| Molecular Formula | C39H42N2O6 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.30 |
| IUPAC Name | [4-[5-[[4-(4-propoxybenzoyl)oxyphenyl]methylideneamino]pentyliminomethyl]phenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N/CCCCC/N=C/c3ccc(OC(=O)c4ccc(OCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H42N2O6/c1-3-26-44-34-20-12-32(13-21-34)38(42)46-36-16-8-30(9-17-36)28-40-24-6-5-7-25-41-29-31-10-18-37(19-11-31)47-39(43)33-14-22-35(23-15-33)45-27-4-2/h8-23,28-29H,3-7,24-27H2,1-2H3/b40-28+,41-29+ |
| InChIKey | JTWNUMDOLBMIKO-ICKILNQYSA-N |
| XLogP | 8.41 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|