C20H22N2O4 — CID 6029290
[4-[(E)-(acetylhydrazinylidene)methyl]phenyl] 4-butoxybenzoate (PubChem CID 6029290) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is [4-[(E)-(acetylhydrazinylidene)methyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[(E)-(acetylhydrazinylidene)methyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 6029290 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [4-[(E)-(acetylhydrazinylidene)methyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=N/NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-4-13-25-18-11-7-17(8-12-18)20(24)26-19-9-5-16(6-10-19)14-21-22-15(2)23/h5-12,14H,3-4,13H2,1-2H3,(H,22,23)/b21-14+ |
| InChIKey | FDGNOKXTONZLFK-KGENOOAVSA-N |
| XLogP | 3.55 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|