C17H16N2O3 — CID 5115377
[4-[(acetylhydrazinylidene)methyl]phenyl] 4-methylbenzoate (PubChem CID 5115377) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is [4-[(acetylhydrazinylidene)methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(acetylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 5115377 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [4-[(acetylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
| SMILES | CC(=O)NN=Cc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-12-3-7-15(8-4-12)17(21)22-16-9-5-14(6-10-16)11-18-19-13(2)20/h3-11H,1-2H3,(H,19,20) |
| InChIKey | IHGIATJNIOGGOI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|