C32H28Cl2N2O6 — CID 3591748
[4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-butoxybenzoate (PubChem CID 3591748) has the molecular formula C32H28Cl2N2O6 and a molecular weight of 607.49 g/mol. Its IUPAC name is [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 3591748 |
| Molecular Formula | C32H28Cl2N2O6 |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | [4-[[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(Oc3ccc(Cl)cc3)Oc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H28Cl2N2O6/c1-2-3-20-39-26-14-6-23(7-15-26)31(38)40-27-12-4-22(5-13-27)21-35-36-30(37)32(41-28-16-8-24(33)9-17-28)42-29-18-10-25(34)11-19-29/h4-19,21,32H,2-3,20H2,1H3,(H,36,37) |
| InChIKey | ISFZPOIHIJXGGS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|