C36H36N2O6 — CID 101016570
[4-[4-[[4-(4-ethoxybenzoyl)oxyphenyl]methylideneamino]butyliminomethyl]phenyl] 4-ethoxybenzoate (PubChem CID 101016570) has the molecular formula C36H36N2O6 and a molecular weight of 592.69 g/mol. Its IUPAC name is [4-[4-[[4-(4-ethoxybenzoyl)oxyphenyl]methylideneamino]butyliminomethyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-[4-[[4-(4-ethoxybenzoyl)oxyphenyl]methylideneamino]butyliminomethyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 101016570 |
| Molecular Formula | C36H36N2O6 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | [4-[4-[[4-(4-ethoxybenzoyl)oxyphenyl]methylideneamino]butyliminomethyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(/C=N/CCCC/N=C/c3ccc(OC(=O)c4ccc(OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H36N2O6/c1-3-41-31-19-11-29(12-20-31)35(39)43-33-15-7-27(8-16-33)25-37-23-5-6-24-38-26-28-9-17-34(18-10-28)44-36(40)30-13-21-32(22-14-30)42-4-2/h7-22,25-26H,3-6,23-24H2,1-2H3/b37-25+,38-26+ |
| InChIKey | IJSZOPCNGBHDLX-USKKBRKXSA-N |
| XLogP | 7.24 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|