C22H28FNO — CID 23343872
N-(2-ethylhexyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]methanimine (PubChem CID 23343872) has the molecular formula C22H28FNO and a molecular weight of 341.47 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(2-ethylhexyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 23343872 |
| Molecular Formula | C22H28FNO |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-(2-ethylhexyl)-1-[4-[(4-fluorophenyl)methoxy]phenyl]methanimine |
| SMILES | CCCCC(CC)C/N=C/c1ccc(OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H28FNO/c1-3-5-6-18(4-2)15-24-16-19-9-13-22(14-10-19)25-17-20-7-11-21(23)12-8-20/h7-14,16,18H,3-6,15,17H2,1-2H3/b24-16+ |
| InChIKey | VMXKXMGGQWWTBN-LFVJCYFKSA-N |
| XLogP | 6.04 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|