C23H31NO — CID 23343862
N-(2-ethylhexyl)-1-[4-[(3-methylphenyl)methoxy]phenyl]methanimine (PubChem CID 23343862) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-[4-[(3-methylphenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(2-ethylhexyl)-1-[4-[(3-methylphenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 23343862 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-(2-ethylhexyl)-1-[4-[(3-methylphenyl)methoxy]phenyl]methanimine |
| SMILES | CCCCC(CC)C/N=C/c1ccc(OCc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-4-6-9-20(5-2)16-24-17-21-11-13-23(14-12-21)25-18-22-10-7-8-19(3)15-22/h7-8,10-15,17,20H,4-6,9,16,18H2,1-3H3/b24-17+ |
| InChIKey | NRGDGPSFYFSDLO-JJIBRWJFSA-N |
| XLogP | 6.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|