C15H11F3O6S — CID 13376815
1-hydroxy-2-oxo-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid (PubChem CID 13376815) has the molecular formula C15H11F3O6S and a molecular weight of 376.31 g/mol. Its IUPAC name is 1-hydroxy-2-oxo-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid.
| Compound Name | 1-hydroxy-2-oxo-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 13376815 |
| Molecular Formula | C15H11F3O6S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-hydroxy-2-oxo-2-[4-[4-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid |
| SMILES | O=C(c1ccc(Oc2ccc(C(F)(F)F)cc2)cc1)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C15H11F3O6S/c16-15(17,18)10-3-7-12(8-4-10)24-11-5-1-9(2-6-11)13(19)14(20)25(21,22)23/h1-8,14,20H,(H,21,22,23) |
| InChIKey | NSMUYCOLMCOMKQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|