C15H22N4O2 — CID 86781803
tert-butyl N-[2-[(6-cyano-3-pyridinyl)-methylamino]ethyl]-N-methylcarbamate (PubChem CID 86781803) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is tert-butyl N-[2-[(6-cyano-3-pyridinyl)-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(6-cyano-3-pyridinyl)-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86781803 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | tert-butyl N-[2-[(6-cyano-3-pyridinyl)-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)c1ccc(C#N)nc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N4O2/c1-15(2,3)21-14(20)19(5)9-8-18(4)13-7-6-12(10-16)17-11-13/h6-7,11H,8-9H2,1-5H3 |
| InChIKey | UTHQMHUALZFWDA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |