C11H12N4 — CID 115487373
5-[2-cyanopropyl(methyl)amino]pyridine-2-carbonitrile (PubChem CID 115487373) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 5-[2-cyanopropyl(methyl)amino]pyridine-2-carbonitrile.
| Compound Name | 5-[2-cyanopropyl(methyl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115487373 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-[2-cyanopropyl(methyl)amino]pyridine-2-carbonitrile |
| SMILES | CC(C#N)CN(C)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C11H12N4/c1-9(5-12)8-15(2)11-4-3-10(6-13)14-7-11/h3-4,7,9H,8H2,1-2H3 |
| InChIKey | ZHKAVJWFZIPMMY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |