C10H14N4 — CID 130563574
5-[2-aminopropyl(methyl)amino]pyridine-2-carbonitrile (PubChem CID 130563574) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-[2-aminopropyl(methyl)amino]pyridine-2-carbonitrile.
| Compound Name | 5-[2-aminopropyl(methyl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 130563574 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-[2-aminopropyl(methyl)amino]pyridine-2-carbonitrile |
| SMILES | CC(N)CN(C)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C10H14N4/c1-8(12)7-14(2)10-4-3-9(5-11)13-6-10/h3-4,6,8H,7,12H2,1-2H3 |
| InChIKey | QLMJCIHELLPOMY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |