C26H41ClN4O4 — CID 10649329
tert-butyl N-[N'-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(4-pyrrolidin-1-ylbutyl)carbamate (PubChem CID 10649329) has the molecular formula C26H41ClN4O4 and a molecular weight of 509.09 g/mol. Its IUPAC name is tert-butyl N-[N'-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(4-pyrrolidin-1-ylbutyl)carbamate.
| Compound Name | tert-butyl N-[N'-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(4-pyrrolidin-1-ylbutyl)carbamate |
|---|---|
| PubChem CID | 10649329 |
| Molecular Formula | C26H41ClN4O4 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | tert-butyl N-[N'-[(4-chlorophenyl)methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(4-pyrrolidin-1-ylbutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\Cc1ccc(Cl)cc1)N(CCCCN1CCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41ClN4O4/c1-25(2,3)34-23(32)29-22(28-19-20-11-13-21(27)14-12-20)31(24(33)35-26(4,5)6)18-10-9-17-30-15-7-8-16-30/h11-14H,7-10,15-19H2,1-6H3,(H,28,29,32) |
| InChIKey | WKPRIXMMOYQFMM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|