C27H50N4O4 — CID 11799398
tert-butyl N-[N'-(cyclohexylmethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(5-pyrrolidin-1-ylpentyl)carbamate (PubChem CID 11799398) has the molecular formula C27H50N4O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is tert-butyl N-[N'-(cyclohexylmethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(5-pyrrolidin-1-ylpentyl)carbamate.
| Compound Name | tert-butyl N-[N'-(cyclohexylmethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(5-pyrrolidin-1-ylpentyl)carbamate |
|---|---|
| PubChem CID | 11799398 |
| Molecular Formula | C27H50N4O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | tert-butyl N-[N'-(cyclohexylmethyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-(5-pyrrolidin-1-ylpentyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\CC1CCCCC1)N(CCCCCN1CCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H50N4O4/c1-26(2,3)34-24(32)29-23(28-21-22-15-9-7-10-16-22)31(25(33)35-27(4,5)6)20-12-8-11-17-30-18-13-14-19-30/h22H,7-21H2,1-6H3,(H,28,29,32) |
| InChIKey | PPFVXPSTRTTWOH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|