C22H42N4O3 — CID 11122462
tert-butyl N-[N-[(2S)-1-(butylamino)-3-methyl-1-oxobutan-2-yl]-N'-(cyclohexylmethyl)carbamimidoyl]carbamate (PubChem CID 11122462) has the molecular formula C22H42N4O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is tert-butyl N-[N-[(2S)-1-(butylamino)-3-methyl-1-oxobutan-2-yl]-N'-(cyclohexylmethyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2S)-1-(butylamino)-3-methyl-1-oxobutan-2-yl]-N'-(cyclohexylmethyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 11122462 |
| Molecular Formula | C22H42N4O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | tert-butyl N-[N-[(2S)-1-(butylamino)-3-methyl-1-oxobutan-2-yl]-N'-(cyclohexylmethyl)carbamimidoyl]carbamate |
| SMILES | CCCCNC(=O)[C@@H](N/C(=N/CC1CCCCC1)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H42N4O3/c1-7-8-14-23-19(27)18(16(2)3)25-20(26-21(28)29-22(4,5)6)24-15-17-12-10-9-11-13-17/h16-18H,7-15H2,1-6H3,(H,23,27)(H2,24,25,26,28)/t18-/m0/s1 |
| InChIKey | CARVWAUQVTUYOP-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|