C17H32N4O4 — CID 53330323
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(piperidin-4-ylmethyl)carbamimidoyl]carbamate (PubChem CID 53330323) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(piperidin-4-ylmethyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(piperidin-4-ylmethyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 53330323 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(piperidin-4-ylmethyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=NCC1CCNCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N4O4/c1-16(2,3)24-14(22)20-13(21-15(23)25-17(4,5)6)19-11-12-7-9-18-10-8-12/h12,18H,7-11H2,1-6H3,(H2,19,20,21,22,23) |
| InChIKey | SUJMAWGPZBOIPY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|