C17H31N3O2 — CID 176897655
tert-butyl N-[3-(2-piperidin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate (PubChem CID 176897655) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl N-[3-(2-piperidin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate.
| Compound Name | tert-butyl N-[3-(2-piperidin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
|---|---|
| PubChem CID | 176897655 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | tert-butyl N-[3-(2-piperidin-4-ylethyl)-3-azabicyclo[3.1.0]hexan-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C2CN(CCC3CCNCC3)CC21 |
| InChI | InChI=1S/C17H31N3O2/c1-17(2,3)22-16(21)19-15-13-10-20(11-14(13)15)9-6-12-4-7-18-8-5-12/h12-15,18H,4-11H2,1-3H3,(H,19,21) |
| InChIKey | AUICEMSJBYQIPG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |