C11H22N2O2 — CID 156824590
tert-butyl N-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)carbamate;molecular hydrogen (PubChem CID 156824590) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 156824590 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | tert-butyl N-(3-methyl-3-azabicyclo[3.1.0]hexan-6-yl)carbamate;molecular hydrogen |
| SMILES | CN1CC2C(C1)C2NC(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C11H20N2O2.H2/c1-11(2,3)15-10(14)12-9-7-5-13(4)6-8(7)9;/h7-9H,5-6H2,1-4H3,(H,12,14);1H |
| InChIKey | CHOGKAAQVZUBSJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |