C26H42N4O5 — CID 22500480
tert-butyl N-[(4-methoxyphenyl)methyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(3-pyrrolidin-1-ylpropyl)carbamimidoyl]carbamate (PubChem CID 22500480) has the molecular formula C26H42N4O5 and a molecular weight of 490.65 g/mol. Its IUPAC name is tert-butyl N-[(4-methoxyphenyl)methyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(3-pyrrolidin-1-ylpropyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[(4-methoxyphenyl)methyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(3-pyrrolidin-1-ylpropyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 22500480 |
| Molecular Formula | C26H42N4O5 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | tert-butyl N-[(4-methoxyphenyl)methyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(3-pyrrolidin-1-ylpropyl)carbamimidoyl]carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)/C(=N/CCCN2CCCC2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H42N4O5/c1-25(2,3)34-23(31)28-22(27-15-10-18-29-16-8-9-17-29)30(24(32)35-26(4,5)6)19-20-11-13-21(33-7)14-12-20/h11-14H,8-10,15-19H2,1-7H3,(H,27,28,31) |
| InChIKey | ZDZBUABICTXYJA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|