C33H46Cl2N4O4 — CID 54261247
tert-butyl N-[(4-chlorophenyl)methyl]-N-[N-[(4-chlorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]carbamate (PubChem CID 54261247) has the molecular formula C33H46Cl2N4O4 and a molecular weight of 633.66 g/mol. Its IUPAC name is tert-butyl N-[(4-chlorophenyl)methyl]-N-[N-[(4-chlorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-[N-[(4-chlorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 54261247 |
| Molecular Formula | C33H46Cl2N4O4 |
| Molecular Weight | 633.66 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | tert-butyl N-[(4-chlorophenyl)methyl]-N-[N-[(4-chlorophenyl)methyl]-N'-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-pyrrolidin-1-ylbutyl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N(CCCCN1CCCC1)Cc1ccc(Cl)cc1)N(Cc1ccc(Cl)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H46Cl2N4O4/c1-32(2,3)42-30(40)36-29(39(31(41)43-33(4,5)6)24-26-13-17-28(35)18-14-26)38(23-25-11-15-27(34)16-12-25)22-10-9-21-37-19-7-8-20-37/h11-18H,7-10,19-24H2,1-6H3 |
| InChIKey | RDQMFRPKNFOZSE-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 74.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.66 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|