C26H38N4O6 — CID 122396182
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[2-(phenylmethoxycarbonylamino)ethyl]carbamimidoyl]-N-pent-4-ynylcarbamate (PubChem CID 122396182) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[2-(phenylmethoxycarbonylamino)ethyl]carbamimidoyl]-N-pent-4-ynylcarbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[2-(phenylmethoxycarbonylamino)ethyl]carbamimidoyl]-N-pent-4-ynylcarbamate |
|---|---|
| PubChem CID | 122396182 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-[2-(phenylmethoxycarbonylamino)ethyl]carbamimidoyl]-N-pent-4-ynylcarbamate |
| SMILES | C#CCCCN(C(=O)OC(C)(C)C)/C(=N/CCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N4O6/c1-8-9-13-18-30(24(33)36-26(5,6)7)21(29-23(32)35-25(2,3)4)27-16-17-28-22(31)34-19-20-14-11-10-12-15-20/h1,10-12,14-15H,9,13,16-19H2,2-7H3,(H,28,31)(H,27,29,32) |
| InChIKey | ZGKWOBRVLLIQRV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|