C16H25NO5 — CID 21352990
tert-butyl N-ethyl-N-[(2-hydroxy-4,6-dimethoxyphenyl)methyl]carbamate (PubChem CID 21352990) has the molecular formula C16H25NO5 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(2-hydroxy-4,6-dimethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[(2-hydroxy-4,6-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 21352990 |
| Molecular Formula | C16H25NO5 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | tert-butyl N-ethyl-N-[(2-hydroxy-4,6-dimethoxyphenyl)methyl]carbamate |
| SMILES | CCN(Cc1c(O)cc(OC)cc1OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO5/c1-7-17(15(19)22-16(2,3)4)10-12-13(18)8-11(20-5)9-14(12)21-6/h8-9,18H,7,10H2,1-6H3 |
| InChIKey | CABSJUVBKZPQHU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|