C19H29NO5 — CID 88898761
tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-oxopentyl)carbamate (PubChem CID 88898761) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-oxopentyl)carbamate.
| Compound Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-oxopentyl)carbamate |
|---|---|
| PubChem CID | 88898761 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-oxopentyl)carbamate |
| SMILES | COc1ccc(CN(CCCCC=O)C(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H29NO5/c1-19(2,3)25-18(22)20(11-7-6-8-12-21)14-15-9-10-16(23-4)13-17(15)24-5/h9-10,12-13H,6-8,11,14H2,1-5H3 |
| InChIKey | GHPCZLKKUULXNV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|