C28H43N3O9 — CID 135383578
methyl 5-[(2,4-dimethoxyphenyl)methyl-[4-(prop-2-enoxycarbonylamino)butyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 135383578) has the molecular formula C28H43N3O9 and a molecular weight of 565.66 g/mol. Its IUPAC name is methyl 5-[(2,4-dimethoxyphenyl)methyl-[4-(prop-2-enoxycarbonylamino)butyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | methyl 5-[(2,4-dimethoxyphenyl)methyl-[4-(prop-2-enoxycarbonylamino)butyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 135383578 |
| Molecular Formula | C28H43N3O9 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | methyl 5-[(2,4-dimethoxyphenyl)methyl-[4-(prop-2-enoxycarbonylamino)butyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | C=CCOC(=O)NCCCCN(Cc1ccc(OC)cc1OC)C(=O)CCC(NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C28H43N3O9/c1-8-17-39-26(34)29-15-9-10-16-31(19-20-11-12-21(36-5)18-23(20)37-6)24(32)14-13-22(25(33)38-7)30-27(35)40-28(2,3)4/h8,11-12,18,22H,1,9-10,13-17,19H2,2-7H3,(H,29,34)(H,30,35) |
| InChIKey | WJZNZBVFSBGWMX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|