C18H24BrNO3 — CID 143222329
N-(2-bromoprop-2-enyl)-N-[(2,4-dimethoxyphenyl)methyl]hex-5-enamide (PubChem CID 143222329) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N-[(2,4-dimethoxyphenyl)methyl]hex-5-enamide.
| Compound Name | N-(2-bromoprop-2-enyl)-N-[(2,4-dimethoxyphenyl)methyl]hex-5-enamide |
|---|---|
| PubChem CID | 143222329 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N-[(2,4-dimethoxyphenyl)methyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)N(CC(=C)Br)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H24BrNO3/c1-5-6-7-8-18(21)20(12-14(2)19)13-15-9-10-16(22-3)11-17(15)23-4/h5,9-11H,1-2,6-8,12-13H2,3-4H3 |
| InChIKey | YPFPFOVRMDLPFB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|