C24H28N2O5 — CID 22293266
[1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxopent-4-en-2-yl]carbamic acid (PubChem CID 22293266) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxopent-4-en-2-yl]carbamic acid.
| Compound Name | [1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxopent-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22293266 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxopent-4-en-2-yl]carbamic acid |
| SMILES | C=CCC(NC(=O)O)C(=O)N(CC(=C)c1ccccc1)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C24H28N2O5/c1-5-9-21(25-24(28)29)23(27)26(15-17(2)18-10-7-6-8-11-18)16-19-12-13-20(30-3)14-22(19)31-4/h5-8,10-14,21,25H,1-2,9,15-16H2,3-4H3,(H,28,29) |
| InChIKey | RYEQCLHADPJQQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|