C29H33FN2O5 — CID 144615588
1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[1-(2-fluorophenyl)but-3-enyl]urea (PubChem CID 144615588) has the molecular formula C29H33FN2O5 and a molecular weight of 508.59 g/mol. Its IUPAC name is 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[1-(2-fluorophenyl)but-3-enyl]urea.
| Compound Name | 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[1-(2-fluorophenyl)but-3-enyl]urea |
|---|---|
| PubChem CID | 144615588 |
| Molecular Formula | C29H33FN2O5 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[1-(2-fluorophenyl)but-3-enyl]urea |
| SMILES | C=CCC(NC(=O)N(Cc1ccc(OC)cc1OC)Cc1ccc(OC)cc1OC)c1ccccc1F |
| InChI | InChI=1S/C29H33FN2O5/c1-6-9-26(24-10-7-8-11-25(24)30)31-29(33)32(18-20-12-14-22(34-2)16-27(20)36-4)19-21-13-15-23(35-3)17-28(21)37-5/h6-8,10-17,26H,1,9,18-19H2,2-5H3,(H,31,33) |
| InChIKey | OQCLEFZOXLPWTQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|