C19H26F3NO5 — CID 143425681
ethane;methyl 3-[(2,4-dimethoxyphenyl)methyl-[(E)-4,4,4-trifluorobut-2-enyl]amino]-3-oxopropanoate (PubChem CID 143425681) has the molecular formula C19H26F3NO5 and a molecular weight of 405.41 g/mol. Its IUPAC name is ethane;methyl 3-[(2,4-dimethoxyphenyl)methyl-[(E)-4,4,4-trifluorobut-2-enyl]amino]-3-oxopropanoate.
| Compound Name | ethane;methyl 3-[(2,4-dimethoxyphenyl)methyl-[(E)-4,4,4-trifluorobut-2-enyl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 143425681 |
| Molecular Formula | C19H26F3NO5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethane;methyl 3-[(2,4-dimethoxyphenyl)methyl-[(E)-4,4,4-trifluorobut-2-enyl]amino]-3-oxopropanoate |
| SMILES | CC.COC(=O)CC(=O)N(C/C=C/C(F)(F)F)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H20F3NO5.C2H6/c1-24-13-6-5-12(14(9-13)25-2)11-21(8-4-7-17(18,19)20)15(22)10-16(23)26-3;1-2/h4-7,9H,8,10-11H2,1-3H3;1-2H3/b7-4+; |
| InChIKey | DODDCUIMFCXZAB-KQGICBIGSA-N |
| XLogP | 3.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|