C29H33FN2O6 — CID 144942805
1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[(2S)-2-(2-fluorophenyl)-4-oxobutan-2-yl]urea (PubChem CID 144942805) has the molecular formula C29H33FN2O6 and a molecular weight of 524.59 g/mol. Its IUPAC name is 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[(2S)-2-(2-fluorophenyl)-4-oxobutan-2-yl]urea.
| Compound Name | 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[(2S)-2-(2-fluorophenyl)-4-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 144942805 |
| Molecular Formula | C29H33FN2O6 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1,1-bis[(2,4-dimethoxyphenyl)methyl]-3-[(2S)-2-(2-fluorophenyl)-4-oxobutan-2-yl]urea |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)C(=O)N[C@@](C)(CC=O)c2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C29H33FN2O6/c1-29(14-15-33,24-8-6-7-9-25(24)30)31-28(34)32(18-20-10-12-22(35-2)16-26(20)37-4)19-21-11-13-23(36-3)17-27(21)38-5/h6-13,15-17H,14,18-19H2,1-5H3,(H,31,34)/t29-/m0/s1 |
| InChIKey | ZGFVMAFVCCZRCK-LJAQVGFWSA-N |
| XLogP | 5.08 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|