C31H34N2O5 — CID 66939205
[(2R)-1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxo-6-phenylhex-4-en-2-yl]carbamic acid (PubChem CID 66939205) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(2R)-1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxo-6-phenylhex-4-en-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxo-6-phenylhex-4-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66939205 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [(2R)-1-[(2,4-dimethoxyphenyl)methyl-(2-phenylprop-2-enyl)amino]-1-oxo-6-phenylhex-4-en-2-yl]carbamic acid |
| SMILES | C=C(CN(Cc1ccc(OC)cc1OC)C(=O)[C@@H](CC=CCc1ccccc1)NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C31H34N2O5/c1-23(25-15-8-5-9-16-25)21-33(22-26-18-19-27(37-2)20-29(26)38-3)30(34)28(32-31(35)36)17-11-10-14-24-12-6-4-7-13-24/h4-13,15-16,18-20,28,32H,1,14,17,21-22H2,2-3H3,(H,35,36)/t28-/m1/s1 |
| InChIKey | OOOWFOKIYBGHSC-MUUNZHRXSA-N |
| XLogP | 5.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|