C16H24O3 — CID 175249444
2,4-dimethoxy-1-prop-2-enylbenzene;pentan-3-one (PubChem CID 175249444) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2,4-dimethoxy-1-prop-2-enylbenzene;pentan-3-one.
| Compound Name | 2,4-dimethoxy-1-prop-2-enylbenzene;pentan-3-one |
|---|---|
| PubChem CID | 175249444 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2,4-dimethoxy-1-prop-2-enylbenzene;pentan-3-one |
| SMILES | C=CCc1ccc(OC)cc1OC.CCC(=O)CC |
| InChI | InChI=1S/C11H14O2.C5H10O/c1-4-5-9-6-7-10(12-2)8-11(9)13-3;1-3-5(6)4-2/h4,6-8H,1,5H2,2-3H3;3-4H2,1-2H3 |
| InChIKey | IKYKPSPFOQZCNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|