C24H31NO5 — CID 11844639
(E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 11844639) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11844639 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (E)-N-[(2,4-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(Cc2ccc(OC)cc2OC)CC(C)(C)CO)cc1 |
| InChI | InChI=1S/C24H31NO5/c1-24(2,17-26)16-25(15-19-9-12-21(29-4)14-22(19)30-5)23(27)13-8-18-6-10-20(28-3)11-7-18/h6-14,26H,15-17H2,1-5H3/b13-8+ |
| InChIKey | DHNUDSZPRSQEFW-MDWZMJQESA-N |
| XLogP | 3.77 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|