C17H17NO4 — CID 66561051
(E)-N-hydroxy-N,3-bis(4-methoxyphenyl)prop-2-enamide (PubChem CID 66561051) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (E)-N-hydroxy-N,3-bis(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-hydroxy-N,3-bis(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 66561051 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (E)-N-hydroxy-N,3-bis(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-21-15-8-3-13(4-9-15)5-12-17(19)18(20)14-6-10-16(22-2)11-7-14/h3-12,20H,1-2H3/b12-5+ |
| InChIKey | APFQWMYRJGVEOG-LFYBBSHMSA-N |
| XLogP | 3.14 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|